C8H16F3NO2SSi — CID 125492184
4,4-dimethyl-1-(trifluoromethylsulfonyl)-1,4-azasilepane (PubChem CID 125492184) has the molecular formula C8H16F3NO2SSi and a molecular weight of 275.37 g/mol. Its IUPAC name is 4,4-dimethyl-1-(trifluoromethylsulfonyl)-1,4-azasilepane.
| Compound Name | 4,4-dimethyl-1-(trifluoromethylsulfonyl)-1,4-azasilepane |
|---|---|
| PubChem CID | 125492184 |
| Molecular Formula | C8H16F3NO2SSi |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 4,4-dimethyl-1-(trifluoromethylsulfonyl)-1,4-azasilepane |
| SMILES | C[Si]1(C)CCCN(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H16F3NO2SSi/c1-16(2)6-3-4-12(5-7-16)15(13,14)8(9,10)11/h3-7H2,1-2H3 |
| InChIKey | DPOPANVGCKWMJF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|