C13H20F8N2O6S3 — CID 123151093
1-methyl-4-[1,1,2,2,3-pentafluoro-3-[3-(trifluoromethylsulfonyl)butan-2-ylsulfonyl]propyl]sulfonylpiperazine (PubChem CID 123151093) has the molecular formula C13H20F8N2O6S3 and a molecular weight of 548.50 g/mol. Its IUPAC name is 1-methyl-4-[1,1,2,2,3-pentafluoro-3-[3-(trifluoromethylsulfonyl)butan-2-ylsulfonyl]propyl]sulfonylpiperazine.
| Compound Name | 1-methyl-4-[1,1,2,2,3-pentafluoro-3-[3-(trifluoromethylsulfonyl)butan-2-ylsulfonyl]propyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 123151093 |
| Molecular Formula | C13H20F8N2O6S3 |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 548.04 |
| IUPAC Name | 1-methyl-4-[1,1,2,2,3-pentafluoro-3-[3-(trifluoromethylsulfonyl)butan-2-ylsulfonyl]propyl]sulfonylpiperazine |
| SMILES | CC(C(C)S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C13H20F8N2O6S3/c1-8(9(2)31(26,27)13(19,20)21)30(24,25)10(14)11(15,16)12(17,18)32(28,29)23-6-4-22(3)5-7-23/h8-10H,4-7H2,1-3H3 |
| InChIKey | VXWAMDZODADIHO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|