C9H23N3O4S — CID 67593861
sulfuric acid;1,4,7-trimethyl-1,4,7-triazonane (PubChem CID 67593861) has the molecular formula C9H23N3O4S and a molecular weight of 269.37 g/mol. Its IUPAC name is sulfuric acid;1,4,7-trimethyl-1,4,7-triazonane.
| Compound Name | sulfuric acid;1,4,7-trimethyl-1,4,7-triazonane |
|---|---|
| PubChem CID | 67593861 |
| Molecular Formula | C9H23N3O4S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | sulfuric acid;1,4,7-trimethyl-1,4,7-triazonane |
| SMILES | CN1CCN(C)CCN(C)CC1.O=S(=O)(O)O |
| InChI | InChI=1S/C9H21N3.H2O4S/c1-10-4-6-11(2)8-9-12(3)7-5-10;1-5(2,3)4/h4-9H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | CGDSLSBXLOWUCF-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|