C14H21F6NO4S2 — CID 170389689
(2R)-5-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-3,3,4,4,5,5-hexafluoropentane-2-sulfinic acid (PubChem CID 170389689) has the molecular formula C14H21F6NO4S2 and a molecular weight of 445.45 g/mol. Its IUPAC name is (2R)-5-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-3,3,4,4,5,5-hexafluoropentane-2-sulfinic acid.
| Compound Name | (2R)-5-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-3,3,4,4,5,5-hexafluoropentane-2-sulfinic acid |
|---|---|
| PubChem CID | 170389689 |
| Molecular Formula | C14H21F6NO4S2 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | (2R)-5-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-3,3,4,4,5,5-hexafluoropentane-2-sulfinic acid |
| SMILES | C[C@@H](S(=O)O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C14H21F6NO4S2/c1-9(26(22)23)12(15,16)13(17,18)14(19,20)27(24,25)21-7-6-10-4-2-3-5-11(10)8-21/h9-11H,2-8H2,1H3,(H,22,23)/t9-,10?,11?/m1/s1 |
| InChIKey | CAXUMSLVTXJVGN-KPPDAEKUSA-N |
| XLogP | 3.30 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|