C9H14F3NO2S — CID 86276451
(3aR,7aS)-1-(trifluoromethylsulfonyl)-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 86276451) has the molecular formula C9H14F3NO2S and a molecular weight of 257.28 g/mol. Its IUPAC name is (3aR,7aS)-1-(trifluoromethylsulfonyl)-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | (3aR,7aS)-1-(trifluoromethylsulfonyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 86276451 |
| Molecular Formula | C9H14F3NO2S |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (3aR,7aS)-1-(trifluoromethylsulfonyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | O=S(=O)(N1CC[C@H]2CCCC[C@@H]21)C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO2S/c10-9(11,12)16(14,15)13-6-5-7-3-1-2-4-8(7)13/h7-8H,1-6H2/t7-,8+/m1/s1 |
| InChIKey | WMWJRKYCUUVJEJ-SFYZADRCSA-N |
| XLogP | 2.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |