C12H17F6NO3S2 — CID 88575552
3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfanyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 88575552) has the molecular formula C12H17F6NO3S2 and a molecular weight of 401.39 g/mol. Its IUPAC name is 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfanyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfanyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 88575552 |
| Molecular Formula | C12H17F6NO3S2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfanyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)SN1CCC2CCCCC2C1 |
| InChI | InChI=1S/C12H17F6NO3S2/c13-10(14,12(17,18)24(20,21)22)11(15,16)23-19-6-5-8-3-1-2-4-9(8)7-19/h8-9H,1-7H2,(H,20,21,22) |
| InChIKey | HXGLKKFACWXCLF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|