C13H16F2N3O4S2- — CID 123763468
[2-[3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl(difluoro)methyl]sulfonyl-2-cyanoethenylidene]azanide (PubChem CID 123763468) has the molecular formula C13H16F2N3O4S2- and a molecular weight of 380.42 g/mol. Its IUPAC name is [2-[3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl(difluoro)methyl]sulfonyl-2-cyanoethenylidene]azanide.
| Compound Name | [2-[3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl(difluoro)methyl]sulfonyl-2-cyanoethenylidene]azanide |
|---|---|
| PubChem CID | 123763468 |
| Molecular Formula | C13H16F2N3O4S2- |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | [2-[3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl(difluoro)methyl]sulfonyl-2-cyanoethenylidene]azanide |
| SMILES | N#CC(=C=[N-])S(=O)(=O)C(F)(F)S(=O)(=O)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C13H16F2N3O4S2/c14-13(15,23(19,20)12(7-16)8-17)24(21,22)18-6-5-10-3-1-2-4-11(10)9-18/h10-11H,1-6,9H2/q-1 |
| InChIKey | XNUGPVDYLXAKQK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 117.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|