About morpholine;morpholine-4-sulfonyl chloride
morpholine;morpholine-4-sulfonyl chloride (PubChem CID 158164193) has the molecular formula C8H17ClN2O4S
and a molecular weight of 272.75 g/mol. Its IUPAC name is morpholine;morpholine-4-sulfonyl chloride.
Molecular Properties
| Compound Name | morpholine;morpholine-4-sulfonyl chloride |
| PubChem CID | 158164193 |
| Molecular Formula | C8H17ClN2O4S |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | morpholine;morpholine-4-sulfonyl chloride |
| SMILES | C1COCCN1.O=S(=O)(Cl)N1CCOCC1 |
| InChI | InChI=1S/C4H8ClNO3S.C4H9NO/c5-10(7,8)6-1-3-9-4-2-6;1-3-6-4-2-5-1/h1-4H2;5H,1-4H2 |
| InChIKey | FWQJACMHZLCQEZ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze morpholine;morpholine-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;morpholine-4-sulfonyl chloride?
The IUPAC name of morpholine;morpholine-4-sulfonyl chloride (CID 158164193) is morpholine;morpholine-4-sulfonyl chloride.
What is the SMILES notation for morpholine;morpholine-4-sulfonyl chloride?
The canonical SMILES for morpholine;morpholine-4-sulfonyl chloride is C1COCCN1.O=S(=O)(Cl)N1CCOCC1.
What is the InChIKey of morpholine;morpholine-4-sulfonyl chloride?
The InChIKey is FWQJACMHZLCQEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClNO3S.C4H9NO/c5-10(7,8)6-1-3-9-4-2-6;1-3-6-4-2-5-1/h1-4H2;5H,1-4H2.
What are the key properties of morpholine;morpholine-4-sulfonyl chloride?
morpholine;morpholine-4-sulfonyl chloride has a molecular weight of 272.75 g/mol, XLogP of -0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;morpholine-4-sulfonyl chloride is sourced from PubChem (CID 158164193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).