morpholine;morpholine-4-sulfonyl chloride

C8H17ClN2O4S — CID 158164193

IUPACmorpholine;morpholine-4-sulfonyl chloride
SMILESC1COCCN1.O=S(=O)(Cl)N1CCOCC1
InChIInChI=1S/C4H8ClNO3S.C4H9NO/c5-10(7,8)6-1-3-9-4-2-6;1-3-6-4-2-5-1/h1-4H2;5H,1-4H2
InChIKeyFWQJACMHZLCQEZ-UHFFFAOYSA-N
MW272.75 g/mol
LogP-0.59
Rot. Bonds1

About morpholine;morpholine-4-sulfonyl chloride

morpholine;morpholine-4-sulfonyl chloride (PubChem CID 158164193) has the molecular formula C8H17ClN2O4S and a molecular weight of 272.75 g/mol. Its IUPAC name is morpholine;morpholine-4-sulfonyl chloride.

Molecular Properties

Compound Namemorpholine;morpholine-4-sulfonyl chloride
PubChem CID158164193
Molecular FormulaC8H17ClN2O4S
Molecular Weight272.75 g/mol
Exact Mass272.06
IUPAC Namemorpholine;morpholine-4-sulfonyl chloride
SMILESC1COCCN1.O=S(=O)(Cl)N1CCOCC1
InChIInChI=1S/C4H8ClNO3S.C4H9NO/c5-10(7,8)6-1-3-9-4-2-6;1-3-6-4-2-5-1/h1-4H2;5H,1-4H2
InChIKeyFWQJACMHZLCQEZ-UHFFFAOYSA-N
XLogP-0.59
TPSA67.87 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.75
LogP ≤ 5-0.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze morpholine;morpholine-4-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of morpholine;morpholine-4-sulfonyl chloride?
The IUPAC name of morpholine;morpholine-4-sulfonyl chloride (CID 158164193) is morpholine;morpholine-4-sulfonyl chloride.
What is the SMILES notation for morpholine;morpholine-4-sulfonyl chloride?
The canonical SMILES for morpholine;morpholine-4-sulfonyl chloride is C1COCCN1.O=S(=O)(Cl)N1CCOCC1.
What is the InChIKey of morpholine;morpholine-4-sulfonyl chloride?
The InChIKey is FWQJACMHZLCQEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClNO3S.C4H9NO/c5-10(7,8)6-1-3-9-4-2-6;1-3-6-4-2-5-1/h1-4H2;5H,1-4H2.
What are the key properties of morpholine;morpholine-4-sulfonyl chloride?
morpholine;morpholine-4-sulfonyl chloride has a molecular weight of 272.75 g/mol, XLogP of -0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;morpholine-4-sulfonyl chloride is sourced from PubChem (CID 158164193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).