C44H62N6O10S4 — CID 15094039
4,7,10,19-tetrakis-(4-methylphenyl)sulfonyl-1,13-dioxa-4,7,10,16,19,22-hexazacyclotetracosane (PubChem CID 15094039) has the molecular formula C44H62N6O10S4 and a molecular weight of 963.28 g/mol. Its IUPAC name is 4,7,10,19-tetrakis-(4-methylphenyl)sulfonyl-1,13-dioxa-4,7,10,16,19,22-hexazacyclotetracosane.
| Compound Name | 4,7,10,19-tetrakis-(4-methylphenyl)sulfonyl-1,13-dioxa-4,7,10,16,19,22-hexazacyclotetracosane |
|---|---|
| PubChem CID | 15094039 |
| Molecular Formula | C44H62N6O10S4 |
| Molecular Weight | 963.28 g/mol |
| Exact Mass | 962.34 |
| IUPAC Name | 4,7,10,19-tetrakis-(4-methylphenyl)sulfonyl-1,13-dioxa-4,7,10,16,19,22-hexazacyclotetracosane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCNCCOCCN(S(=O)(=O)c3ccc(C)cc3)CCN(S(=O)(=O)c3ccc(C)cc3)CCN(S(=O)(=O)c3ccc(C)cc3)CCOCCNCC2)cc1 |
| InChI | InChI=1S/C44H62N6O10S4/c1-37-5-13-41(14-6-37)61(51,52)47-25-21-45-23-33-59-35-31-49(63(55,56)43-17-9-39(3)10-18-43)29-27-48(62(53,54)42-15-7-38(2)8-16-42)28-30-50(32-36-60-34-24-46-22-26-47)64(57,58)44-19-11-40(4)12-20-44/h5-20,45-46H,21-36H2,1-4H3 |
| InChIKey | DEINKRSMAYDWQW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 192.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |