C13H26N4O4S2 — CID 39730535
1,4-bis(pyrrolidin-1-ylsulfonyl)-1,4-diazepane (PubChem CID 39730535) has the molecular formula C13H26N4O4S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1,4-bis(pyrrolidin-1-ylsulfonyl)-1,4-diazepane.
| Compound Name | 1,4-bis(pyrrolidin-1-ylsulfonyl)-1,4-diazepane |
|---|---|
| PubChem CID | 39730535 |
| Molecular Formula | C13H26N4O4S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 1,4-bis(pyrrolidin-1-ylsulfonyl)-1,4-diazepane |
| SMILES | O=S(=O)(N1CCCC1)N1CCCN(S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C13H26N4O4S2/c18-22(19,14-6-1-2-7-14)16-10-5-11-17(13-12-16)23(20,21)15-8-3-4-9-15/h1-13H2 |
| InChIKey | IUNICNWUDPQDML-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |