C8H15N3O4S — CID 104929236
methyl N-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]sulfonyl]carbamate (PubChem CID 104929236) has the molecular formula C8H15N3O4S and a molecular weight of 249.29 g/mol. Its IUPAC name is methyl N-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]sulfonyl]carbamate.
| Compound Name | methyl N-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]sulfonyl]carbamate |
|---|---|
| PubChem CID | 104929236 |
| Molecular Formula | C8H15N3O4S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | methyl N-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]sulfonyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C8H15N3O4S/c1-15-8(12)10-16(13,14)11-3-2-6-4-9-5-7(6)11/h6-7,9H,2-5H2,1H3,(H,10,12)/t6-,7+/m0/s1 |
| InChIKey | WKBWVSLZUVKYDO-NKWVEPMBSA-N |
| XLogP | -1.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |