C10H21N3O2S — CID 104978113
(3aS,6aS)-N-tert-butyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-sulfonamide (PubChem CID 104978113) has the molecular formula C10H21N3O2S and a molecular weight of 247.36 g/mol. Its IUPAC name is (3aS,6aS)-N-tert-butyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-sulfonamide.
| Compound Name | (3aS,6aS)-N-tert-butyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-sulfonamide |
|---|---|
| PubChem CID | 104978113 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (3aS,6aS)-N-tert-butyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C10H21N3O2S/c1-10(2,3)12-16(14,15)13-5-4-8-6-11-7-9(8)13/h8-9,11-12H,4-7H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | INSILPFMJBJGHL-DTWKUNHWSA-N |
| XLogP | -0.09 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |