C12H14Cl2N2O2S — CID 43597639
(3aS,6aS)-1-(2,5-dichlorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 43597639) has the molecular formula C12H14Cl2N2O2S and a molecular weight of 321.23 g/mol. Its IUPAC name is (3aS,6aS)-1-(2,5-dichlorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-1-(2,5-dichlorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 43597639 |
| Molecular Formula | C12H14Cl2N2O2S |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | (3aS,6aS)-1-(2,5-dichlorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | O=S(=O)(c1cc(Cl)ccc1Cl)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C12H14Cl2N2O2S/c13-9-1-2-10(14)12(5-9)19(17,18)16-4-3-8-6-15-7-11(8)16/h1-2,5,8,11,15H,3-4,6-7H2/t8-,11+/m0/s1 |
| InChIKey | XREGXFAOCFWBIC-GZMMTYOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |