C12H14Cl3NO2S — CID 102788504
2-(chloromethyl)-1-(2,5-dichlorophenyl)sulfonyl-3-methylpyrrolidine (PubChem CID 102788504) has the molecular formula C12H14Cl3NO2S and a molecular weight of 342.68 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(2,5-dichlorophenyl)sulfonyl-3-methylpyrrolidine.
| Compound Name | 2-(chloromethyl)-1-(2,5-dichlorophenyl)sulfonyl-3-methylpyrrolidine |
|---|---|
| PubChem CID | 102788504 |
| Molecular Formula | C12H14Cl3NO2S |
| Molecular Weight | 342.68 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 2-(chloromethyl)-1-(2,5-dichlorophenyl)sulfonyl-3-methylpyrrolidine |
| SMILES | CC1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)C1CCl |
| InChI | InChI=1S/C12H14Cl3NO2S/c1-8-4-5-16(11(8)7-13)19(17,18)12-6-9(14)2-3-10(12)15/h2-3,6,8,11H,4-5,7H2,1H3 |
| InChIKey | VTBZEXOEWRJAJT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|