C13H17ClN2O3S — CID 43597628
(3aS,6aS)-1-(4-chloro-2-methoxyphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 43597628) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is (3aS,6aS)-1-(4-chloro-2-methoxyphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-1-(4-chloro-2-methoxyphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 43597628 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (3aS,6aS)-1-(4-chloro-2-methoxyphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | COc1cc(Cl)ccc1S(=O)(=O)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C13H17ClN2O3S/c1-19-12-6-10(14)2-3-13(12)20(17,18)16-5-4-9-7-15-8-11(9)16/h2-3,6,9,11,15H,4-5,7-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | LGVBNWJLGLHXFQ-GXSJLCMTSA-N |
| XLogP | 1.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |