C15H19ClN2O2S — CID 102680781
1-[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102680781) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is 1-[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | 1-[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102680781 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | O=S(=O)(/C=C/c1ccc(Cl)cc1)N1CCCC2CNCC21 |
| InChI | InChI=1S/C15H19ClN2O2S/c16-14-5-3-12(4-6-14)7-9-21(19,20)18-8-1-2-13-10-17-11-15(13)18/h3-7,9,13,15,17H,1-2,8,10-11H2/b9-7+ |
| InChIKey | GTSYIXXAIANYFA-VQHVLOKHSA-N |
| XLogP | 2.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |