C11H22N2O6S2 — CID 43094969
2-[(2-methylpiperidin-1-yl)sulfonylamino]-4-methylsulfonylbutanoic acid (PubChem CID 43094969) has the molecular formula C11H22N2O6S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[(2-methylpiperidin-1-yl)sulfonylamino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[(2-methylpiperidin-1-yl)sulfonylamino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 43094969 |
| Molecular Formula | C11H22N2O6S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-[(2-methylpiperidin-1-yl)sulfonylamino]-4-methylsulfonylbutanoic acid |
| SMILES | CC1CCCCN1S(=O)(=O)NC(CCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C11H22N2O6S2/c1-9-5-3-4-7-13(9)21(18,19)12-10(11(14)15)6-8-20(2,16)17/h9-10,12H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | IDKUBHYAMVKGHZ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |