C9H17NO5S — CID 62675881
2-methyl-3-(oxan-4-ylsulfonylamino)propanoic acid (PubChem CID 62675881) has the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. Its IUPAC name is 2-methyl-3-(oxan-4-ylsulfonylamino)propanoic acid.
| Compound Name | 2-methyl-3-(oxan-4-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 62675881 |
| Molecular Formula | C9H17NO5S |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-methyl-3-(oxan-4-ylsulfonylamino)propanoic acid |
| SMILES | CC(CNS(=O)(=O)C1CCOCC1)C(=O)O |
| InChI | InChI=1S/C9H17NO5S/c1-7(9(11)12)6-10-16(13,14)8-2-4-15-5-3-8/h7-8,10H,2-6H2,1H3,(H,11,12) |
| InChIKey | LDPORXVVKRASNC-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |