C10H19NO5S — CID 115427404
2,2-dimethyl-3-(oxan-4-ylsulfonylamino)propanoic acid (PubChem CID 115427404) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is 2,2-dimethyl-3-(oxan-4-ylsulfonylamino)propanoic acid.
| Compound Name | 2,2-dimethyl-3-(oxan-4-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 115427404 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2,2-dimethyl-3-(oxan-4-ylsulfonylamino)propanoic acid |
| SMILES | CC(C)(CNS(=O)(=O)C1CCOCC1)C(=O)O |
| InChI | InChI=1S/C10H19NO5S/c1-10(2,9(12)13)7-11-17(14,15)8-3-5-16-6-4-8/h8,11H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | KTQFAGDAEJFIBQ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |