3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid

C8H16N2O4S — CID 114533437

IUPAC3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid
SMILESCC(C)(CNS(=O)(=O)NC1CC1)C(=O)O
InChIInChI=1S/C8H16N2O4S/c1-8(2,7(11)12)5-9-15(13,14)10-6-3-4-6/h6,9-10H,3-5H2,1-2H3,(H,11,12)
InChIKeyQTWIOVVVUCDCHP-UHFFFAOYSA-N
MW236.29 g/mol
LogP-0.32
Rot. Bonds6

About 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid

3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid (PubChem CID 114533437) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid
PubChem CID114533437
Molecular FormulaC8H16N2O4S
Molecular Weight236.29 g/mol
Exact Mass236.08
IUPAC Name3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid
SMILESCC(C)(CNS(=O)(=O)NC1CC1)C(=O)O
InChIInChI=1S/C8H16N2O4S/c1-8(2,7(11)12)5-9-15(13,14)10-6-3-4-6/h6,9-10H,3-5H2,1-2H3,(H,11,12)
InChIKeyQTWIOVVVUCDCHP-UHFFFAOYSA-N
XLogP-0.32
TPSA95.50 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.29
LogP ≤ 5-0.32
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid (CID 114533437) is 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid is CC(C)(CNS(=O)(=O)NC1CC1)C(=O)O.
What is the InChIKey of 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid?
The InChIKey is QTWIOVVVUCDCHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O4S/c1-8(2,7(11)12)5-9-15(13,14)10-6-3-4-6/h6,9-10H,3-5H2,1-2H3,(H,11,12).
What are the key properties of 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid?
3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid has a molecular weight of 236.29 g/mol, XLogP of -0.32, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 114533437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).