C11H21NO4S — CID 115427537
3-(cyclohexylsulfonylamino)-2,2-dimethylpropanoic acid (PubChem CID 115427537) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is 3-(cyclohexylsulfonylamino)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(cyclohexylsulfonylamino)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 115427537 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-(cyclohexylsulfonylamino)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CNS(=O)(=O)C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C11H21NO4S/c1-11(2,10(13)14)8-12-17(15,16)9-6-4-3-5-7-9/h9,12H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | DCCYJXKTYHZPTO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |