C9H18F2N2O2S — CID 114383985
N-(3-amino-2,2-difluoropropyl)cyclohexanesulfonamide (PubChem CID 114383985) has the molecular formula C9H18F2N2O2S and a molecular weight of 256.32 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)cyclohexanesulfonamide.
| Compound Name | N-(3-amino-2,2-difluoropropyl)cyclohexanesulfonamide |
|---|---|
| PubChem CID | 114383985 |
| Molecular Formula | C9H18F2N2O2S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)cyclohexanesulfonamide |
| SMILES | NCC(F)(F)CNS(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C9H18F2N2O2S/c10-9(11,6-12)7-13-16(14,15)8-4-2-1-3-5-8/h8,13H,1-7,12H2 |
| InChIKey | GHOFPFRNGDDNEA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |