C11H22ClNO2S — CID 115365303
N-(3-chloro-2,2-dimethylpropyl)cyclohexanesulfonamide (PubChem CID 115365303) has the molecular formula C11H22ClNO2S and a molecular weight of 267.82 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylpropyl)cyclohexanesulfonamide.
| Compound Name | N-(3-chloro-2,2-dimethylpropyl)cyclohexanesulfonamide |
|---|---|
| PubChem CID | 115365303 |
| Molecular Formula | C11H22ClNO2S |
| Molecular Weight | 267.82 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-(3-chloro-2,2-dimethylpropyl)cyclohexanesulfonamide |
| SMILES | CC(C)(CCl)CNS(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C11H22ClNO2S/c1-11(2,8-12)9-13-16(14,15)10-6-4-3-5-7-10/h10,13H,3-9H2,1-2H3 |
| InChIKey | UMEAHYUWWUGMRQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.82 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|