C9H20N2O2S — CID 115270992
N-(3-amino-2,2-dimethylpropyl)cyclobutanesulfonamide (PubChem CID 115270992) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)cyclobutanesulfonamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)cyclobutanesulfonamide |
|---|---|
| PubChem CID | 115270992 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)cyclobutanesulfonamide |
| SMILES | CC(C)(CN)CNS(=O)(=O)C1CCC1 |
| InChI | InChI=1S/C9H20N2O2S/c1-9(2,6-10)7-11-14(12,13)8-4-3-5-8/h8,11H,3-7,10H2,1-2H3 |
| InChIKey | MJZIIBUEZCLWDF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |