C12H26N2O4S2 — CID 106141685
N-(5-amino-2,2-dimethylpentyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 106141685) has the molecular formula C12H26N2O4S2 and a molecular weight of 326.48 g/mol. Its IUPAC name is N-(5-amino-2,2-dimethylpentyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(5-amino-2,2-dimethylpentyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 106141685 |
| Molecular Formula | C12H26N2O4S2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-(5-amino-2,2-dimethylpentyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | CC(C)(CCCN)CNS(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H26N2O4S2/c1-12(2,6-3-7-13)10-14-20(17,18)11-4-8-19(15,16)9-5-11/h11,14H,3-10,13H2,1-2H3 |
| InChIKey | QPQHZWZLYKAFEM-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |