C12H24BrNO2S — CID 106145688
N-(4-bromo-2,2-dimethylbutyl)cyclohexanesulfonamide (PubChem CID 106145688) has the molecular formula C12H24BrNO2S and a molecular weight of 326.30 g/mol. Its IUPAC name is N-(4-bromo-2,2-dimethylbutyl)cyclohexanesulfonamide.
| Compound Name | N-(4-bromo-2,2-dimethylbutyl)cyclohexanesulfonamide |
|---|---|
| PubChem CID | 106145688 |
| Molecular Formula | C12H24BrNO2S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-(4-bromo-2,2-dimethylbutyl)cyclohexanesulfonamide |
| SMILES | CC(C)(CCBr)CNS(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C12H24BrNO2S/c1-12(2,8-9-13)10-14-17(15,16)11-6-4-3-5-7-11/h11,14H,3-10H2,1-2H3 |
| InChIKey | KGRWTFBSGOVZCC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|