C10H20ClNO3S — CID 115365332
N-(3-chloro-2,2-dimethylpropyl)oxane-4-sulfonamide (PubChem CID 115365332) has the molecular formula C10H20ClNO3S and a molecular weight of 269.79 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylpropyl)oxane-4-sulfonamide.
| Compound Name | N-(3-chloro-2,2-dimethylpropyl)oxane-4-sulfonamide |
|---|---|
| PubChem CID | 115365332 |
| Molecular Formula | C10H20ClNO3S |
| Molecular Weight | 269.79 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-(3-chloro-2,2-dimethylpropyl)oxane-4-sulfonamide |
| SMILES | CC(C)(CCl)CNS(=O)(=O)C1CCOCC1 |
| InChI | InChI=1S/C10H20ClNO3S/c1-10(2,7-11)8-12-16(13,14)9-3-5-15-6-4-9/h9,12H,3-8H2,1-2H3 |
| InChIKey | LVWNYZSMCNWZPN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.79 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|