C12H23NO4S — CID 59502986
(cyclohexylsulfonylamino) 2,2-dimethylbutanoate (PubChem CID 59502986) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is (cyclohexylsulfonylamino) 2,2-dimethylbutanoate.
| Compound Name | (cyclohexylsulfonylamino) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59502986 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (cyclohexylsulfonylamino) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)ONS(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C12H23NO4S/c1-4-12(2,3)11(14)17-13-18(15,16)10-8-6-5-7-9-10/h10,13H,4-9H2,1-3H3 |
| InChIKey | XYVGXHFGCNJDQQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|