C14H21NO4 — CID 159276090
(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl) 2,2-dimethylbutanoate (PubChem CID 159276090) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is (1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl) 2,2-dimethylbutanoate.
| Compound Name | (1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 159276090 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | (1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)ON1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C14H21NO4/c1-4-14(2,3)13(18)19-15-11(16)9-7-5-6-8-10(9)12(15)17/h9-10H,4-8H2,1-3H3 |
| InChIKey | IDKIGEONAMBEFI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|