C18H25NO5 — CID 158048788
(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl) 8-oxodec-9-enoate (PubChem CID 158048788) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is (1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl) 8-oxodec-9-enoate.
| Compound Name | (1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl) 8-oxodec-9-enoate |
|---|---|
| PubChem CID | 158048788 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl) 8-oxodec-9-enoate |
| SMILES | C=CC(=O)CCCCCCC(=O)ON1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C18H25NO5/c1-2-13(20)9-5-3-4-6-12-16(21)24-19-17(22)14-10-7-8-11-15(14)18(19)23/h2,14-15H,1,3-12H2 |
| InChIKey | JPEYVMNEDVZSAI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|