C12H21NO6S — CID 61453777
2-(cyclohexylmethylsulfonylamino)pentanedioic acid (PubChem CID 61453777) has the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-(cyclohexylmethylsulfonylamino)pentanedioic acid.
| Compound Name | 2-(cyclohexylmethylsulfonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 61453777 |
| Molecular Formula | C12H21NO6S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-(cyclohexylmethylsulfonylamino)pentanedioic acid |
| SMILES | O=C(O)CCC(NS(=O)(=O)CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C12H21NO6S/c14-11(15)7-6-10(12(16)17)13-20(18,19)8-9-4-2-1-3-5-9/h9-10,13H,1-8H2,(H,14,15)(H,16,17) |
| InChIKey | GIWYDHGFHZZNTO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |