C14H21FN2O3S2 — CID 31759124
(2R)-2-(ethylsulfonylamino)-N-(5-fluoro-2-methylphenyl)-4-methylsulfanylbutanamide (PubChem CID 31759124) has the molecular formula C14H21FN2O3S2 and a molecular weight of 348.47 g/mol. Its IUPAC name is (2R)-2-(ethylsulfonylamino)-N-(5-fluoro-2-methylphenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-(ethylsulfonylamino)-N-(5-fluoro-2-methylphenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 31759124 |
| Molecular Formula | C14H21FN2O3S2 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (2R)-2-(ethylsulfonylamino)-N-(5-fluoro-2-methylphenyl)-4-methylsulfanylbutanamide |
| SMILES | CCS(=O)(=O)N[C@H](CCSC)C(=O)Nc1cc(F)ccc1C |
| InChI | InChI=1S/C14H21FN2O3S2/c1-4-22(19,20)17-12(7-8-21-3)14(18)16-13-9-11(15)6-5-10(13)2/h5-6,9,12,17H,4,7-8H2,1-3H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | ITDZPWMCUIKBDC-GFCCVEGCSA-N |
| XLogP | 2.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |