C19H20BrFN2O2S — CID 134062578
2-bromo-N-[1-(5-fluoro-2-methylanilino)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 134062578) has the molecular formula C19H20BrFN2O2S and a molecular weight of 439.35 g/mol. Its IUPAC name is 2-bromo-N-[1-(5-fluoro-2-methylanilino)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-bromo-N-[1-(5-fluoro-2-methylanilino)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 134062578 |
| Molecular Formula | C19H20BrFN2O2S |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 2-bromo-N-[1-(5-fluoro-2-methylanilino)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CSCCC(NC(=O)c1ccccc1Br)C(=O)Nc1cc(F)ccc1C |
| InChI | InChI=1S/C19H20BrFN2O2S/c1-12-7-8-13(21)11-17(12)23-19(25)16(9-10-26-2)22-18(24)14-5-3-4-6-15(14)20/h3-8,11,16H,9-10H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | HBCIOHBJPDRCLG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |