C14H20BrN3O2S — CID 9164086
2-bromo-N-[(2S)-1-(2,2-dimethylhydrazinyl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 9164086) has the molecular formula C14H20BrN3O2S and a molecular weight of 374.30 g/mol. Its IUPAC name is 2-bromo-N-[(2S)-1-(2,2-dimethylhydrazinyl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-bromo-N-[(2S)-1-(2,2-dimethylhydrazinyl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 9164086 |
| Molecular Formula | C14H20BrN3O2S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 2-bromo-N-[(2S)-1-(2,2-dimethylhydrazinyl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CSCC[C@H](NC(=O)c1ccccc1Br)C(=O)NN(C)C |
| InChI | InChI=1S/C14H20BrN3O2S/c1-18(2)17-14(20)12(8-9-21-3)16-13(19)10-6-4-5-7-11(10)15/h4-7,12H,8-9H2,1-3H3,(H,16,19)(H,17,20)/t12-/m0/s1 |
| InChIKey | IEFUPGAHRAYPOZ-LBPRGKRZSA-N |
| XLogP | 1.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|