C14H19BrN2O3S — CID 51708474
2-bromo-N-[(2S)-1-[methoxy(methyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 51708474) has the molecular formula C14H19BrN2O3S and a molecular weight of 375.29 g/mol. Its IUPAC name is 2-bromo-N-[(2S)-1-[methoxy(methyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-bromo-N-[(2S)-1-[methoxy(methyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 51708474 |
| Molecular Formula | C14H19BrN2O3S |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 2-bromo-N-[(2S)-1-[methoxy(methyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CON(C)C(=O)[C@H](CCSC)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C14H19BrN2O3S/c1-17(20-2)14(19)12(8-9-21-3)16-13(18)10-6-4-5-7-11(10)15/h4-7,12H,8-9H2,1-3H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | FMOUPLBGZMGUEX-LBPRGKRZSA-N |
| XLogP | 2.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|