C18H26BrN3O2S — CID 112759946
2-bromo-N-[1-(4-ethylpiperazin-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 112759946) has the molecular formula C18H26BrN3O2S and a molecular weight of 428.40 g/mol. Its IUPAC name is 2-bromo-N-[1-(4-ethylpiperazin-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-bromo-N-[1-(4-ethylpiperazin-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 112759946 |
| Molecular Formula | C18H26BrN3O2S |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 2-bromo-N-[1-(4-ethylpiperazin-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCN1CCN(C(=O)C(CCSC)NC(=O)c2ccccc2Br)CC1 |
| InChI | InChI=1S/C18H26BrN3O2S/c1-3-21-9-11-22(12-10-21)18(24)16(8-13-25-2)20-17(23)14-6-4-5-7-15(14)19/h4-7,16H,3,8-13H2,1-2H3,(H,20,23) |
| InChIKey | UENSYVNZDSZMSS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |