C24H23BrN2O2S — CID 2473835
2-bromo-N-[(2S)-4-methylsulfanyl-1-oxo-1-(4-phenylanilino)butan-2-yl]benzamide (PubChem CID 2473835) has the molecular formula C24H23BrN2O2S and a molecular weight of 483.43 g/mol. Its IUPAC name is 2-bromo-N-[(2S)-4-methylsulfanyl-1-oxo-1-(4-phenylanilino)butan-2-yl]benzamide.
| Compound Name | 2-bromo-N-[(2S)-4-methylsulfanyl-1-oxo-1-(4-phenylanilino)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 2473835 |
| Molecular Formula | C24H23BrN2O2S |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 2-bromo-N-[(2S)-4-methylsulfanyl-1-oxo-1-(4-phenylanilino)butan-2-yl]benzamide |
| SMILES | CSCC[C@H](NC(=O)c1ccccc1Br)C(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23BrN2O2S/c1-30-16-15-22(27-23(28)20-9-5-6-10-21(20)25)24(29)26-19-13-11-18(12-14-19)17-7-3-2-4-8-17/h2-14,22H,15-16H2,1H3,(H,26,29)(H,27,28)/t22-/m0/s1 |
| InChIKey | NOHWMAGXDMKHCS-QFIPXVFZSA-N |
| XLogP | 5.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |