C20H22BrN3O3S — CID 55861268
N-[1-[(2-anilino-2-oxoethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]-2-bromobenzamide (PubChem CID 55861268) has the molecular formula C20H22BrN3O3S and a molecular weight of 464.39 g/mol. Its IUPAC name is N-[1-[(2-anilino-2-oxoethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]-2-bromobenzamide.
| Compound Name | N-[1-[(2-anilino-2-oxoethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]-2-bromobenzamide |
|---|---|
| PubChem CID | 55861268 |
| Molecular Formula | C20H22BrN3O3S |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | N-[1-[(2-anilino-2-oxoethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]-2-bromobenzamide |
| SMILES | CSCCC(NC(=O)c1ccccc1Br)C(=O)NCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H22BrN3O3S/c1-28-12-11-17(24-19(26)15-9-5-6-10-16(15)21)20(27)22-13-18(25)23-14-7-3-2-4-8-14/h2-10,17H,11-13H2,1H3,(H,22,27)(H,23,25)(H,24,26) |
| InChIKey | KAOXAKGQVRUVAU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |