C14H21FN2O3S2 — CID 94825011
(2S)-2-(ethylsulfonylamino)-N-[(3-fluorophenyl)methyl]-4-methylsulfanylbutanamide (PubChem CID 94825011) has the molecular formula C14H21FN2O3S2 and a molecular weight of 348.47 g/mol. Its IUPAC name is (2S)-2-(ethylsulfonylamino)-N-[(3-fluorophenyl)methyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-(ethylsulfonylamino)-N-[(3-fluorophenyl)methyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 94825011 |
| Molecular Formula | C14H21FN2O3S2 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (2S)-2-(ethylsulfonylamino)-N-[(3-fluorophenyl)methyl]-4-methylsulfanylbutanamide |
| SMILES | CCS(=O)(=O)N[C@@H](CCSC)C(=O)NCc1cccc(F)c1 |
| InChI | InChI=1S/C14H21FN2O3S2/c1-3-22(19,20)17-13(7-8-21-2)14(18)16-10-11-5-4-6-12(15)9-11/h4-6,9,13,17H,3,7-8,10H2,1-2H3,(H,16,18)/t13-/m0/s1 |
| InChIKey | UMETZBABNWANIS-ZDUSSCGKSA-N |
| XLogP | 1.50 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |