C11H21N3O4S2 — CID 62849678
N-[4-methylsulfanyl-1-oxo-1-(3-oxopiperazin-1-yl)butan-2-yl]ethanesulfonamide (PubChem CID 62849678) has the molecular formula C11H21N3O4S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[4-methylsulfanyl-1-oxo-1-(3-oxopiperazin-1-yl)butan-2-yl]ethanesulfonamide.
| Compound Name | N-[4-methylsulfanyl-1-oxo-1-(3-oxopiperazin-1-yl)butan-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 62849678 |
| Molecular Formula | C11H21N3O4S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-[4-methylsulfanyl-1-oxo-1-(3-oxopiperazin-1-yl)butan-2-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC(CCSC)C(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C11H21N3O4S2/c1-3-20(17,18)13-9(4-7-19-2)11(16)14-6-5-12-10(15)8-14/h9,13H,3-8H2,1-2H3,(H,12,15) |
| InChIKey | WGYDQZDVJVPIHQ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |