C17H26N4O7S3 — CID 55363982
N-[4-methylsulfanyl-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-1-oxobutan-2-yl]ethanesulfonamide (PubChem CID 55363982) has the molecular formula C17H26N4O7S3 and a molecular weight of 494.62 g/mol. Its IUPAC name is N-[4-methylsulfanyl-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-1-oxobutan-2-yl]ethanesulfonamide.
| Compound Name | N-[4-methylsulfanyl-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-1-oxobutan-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 55363982 |
| Molecular Formula | C17H26N4O7S3 |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | N-[4-methylsulfanyl-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-1-oxobutan-2-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC(CCSC)C(=O)N1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C17H26N4O7S3/c1-3-30(25,26)18-16(7-12-29-2)17(22)19-8-10-20(11-9-19)31(27,28)15-6-4-5-14(13-15)21(23)24/h4-6,13,16,18H,3,7-12H2,1-2H3 |
| InChIKey | CIOVMOPVHCIVOG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|