C19H25NO5S2 — CID 7963062
methyl 3-[[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]acetyl]amino]-4-methylbenzoate (PubChem CID 7963062) has the molecular formula C19H25NO5S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is methyl 3-[[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]acetyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]acetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 7963062 |
| Molecular Formula | C19H25NO5S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | methyl 3-[[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]acetyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)COC(=O)CCCC[C@@H]2CCSS2)c1 |
| InChI | InChI=1S/C19H25NO5S2/c1-13-7-8-14(19(23)24-2)11-16(13)20-17(21)12-25-18(22)6-4-3-5-15-9-10-26-27-15/h7-8,11,15H,3-6,9-10,12H2,1-2H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | OEGFXSJUDDSMFU-OAHLLOKOSA-N |
| XLogP | 3.98 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|