C15H17N3OS — CID 119287690
N-(5-phenyl-1,3-thiazol-2-yl)piperidine-2-carboxamide (PubChem CID 119287690) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is N-(5-phenyl-1,3-thiazol-2-yl)piperidine-2-carboxamide.
| Compound Name | N-(5-phenyl-1,3-thiazol-2-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119287690 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-(5-phenyl-1,3-thiazol-2-yl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1ncc(-c2ccccc2)s1)C1CCCCN1 |
| InChI | InChI=1S/C15H17N3OS/c19-14(12-8-4-5-9-16-12)18-15-17-10-13(20-15)11-6-2-1-3-7-11/h1-3,6-7,10,12,16H,4-5,8-9H2,(H,17,18,19) |
| InChIKey | PBMFIQHGWUSKAZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |