C21H22N4OS — CID 86855015
4-anilino-N-(5-phenyl-1,3-thiazol-2-yl)piperidine-1-carboxamide (PubChem CID 86855015) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is 4-anilino-N-(5-phenyl-1,3-thiazol-2-yl)piperidine-1-carboxamide.
| Compound Name | 4-anilino-N-(5-phenyl-1,3-thiazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86855015 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 4-anilino-N-(5-phenyl-1,3-thiazol-2-yl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ncc(-c2ccccc2)s1)N1CCC(Nc2ccccc2)CC1 |
| InChI | InChI=1S/C21H22N4OS/c26-21(24-20-22-15-19(27-20)16-7-3-1-4-8-16)25-13-11-18(12-14-25)23-17-9-5-2-6-10-17/h1-10,15,18,23H,11-14H2,(H,22,24,26) |
| InChIKey | VUFPJBBESQKPJH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |