About 2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide
2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 119720410) has the molecular formula C15H17N3OS
and a molecular weight of 287.39 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 119720410 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CNCC1CC1)Nc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C15H17N3OS/c19-14(10-16-8-11-6-7-11)18-15-17-9-13(20-15)12-4-2-1-3-5-12/h1-5,9,11,16H,6-8,10H2,(H,17,18,19) |
| InChIKey | YQQDXAUKSPCWCK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide (CID 119720410) is 2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide is O=C(CNCC1CC1)Nc1ncc(-c2ccccc2)s1.
What is the InChIKey of 2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is YQQDXAUKSPCWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3OS/c19-14(10-16-8-11-6-7-11)18-15-17-9-13(20-15)12-4-2-1-3-5-12/h1-5,9,11,16H,6-8,10H2,(H,17,18,19).
What are the key properties of 2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide?
2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 287.39 g/mol, XLogP of 2.75, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopropylmethylamino)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 119720410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).