C15H12N4OS — CID 47028163
5-methyl-N-(5-phenyl-1,3-thiazol-2-yl)pyrazine-2-carboxamide (PubChem CID 47028163) has the molecular formula C15H12N4OS and a molecular weight of 296.36 g/mol. Its IUPAC name is 5-methyl-N-(5-phenyl-1,3-thiazol-2-yl)pyrazine-2-carboxamide.
| Compound Name | 5-methyl-N-(5-phenyl-1,3-thiazol-2-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 47028163 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 5-methyl-N-(5-phenyl-1,3-thiazol-2-yl)pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2ncc(-c3ccccc3)s2)cn1 |
| InChI | InChI=1S/C15H12N4OS/c1-10-7-17-12(8-16-10)14(20)19-15-18-9-13(21-15)11-5-3-2-4-6-11/h2-9H,1H3,(H,18,19,20) |
| InChIKey | GOWUATJLCAWJHV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |