C23H39N3O2S — CID 155693682
2-(2-cyclohexyl-1,3-thiazol-5-yl)aniline;ethane;propan-2-yl carbamate (PubChem CID 155693682) has the molecular formula C23H39N3O2S and a molecular weight of 421.65 g/mol. Its IUPAC name is 2-(2-cyclohexyl-1,3-thiazol-5-yl)aniline;ethane;propan-2-yl carbamate.
| Compound Name | 2-(2-cyclohexyl-1,3-thiazol-5-yl)aniline;ethane;propan-2-yl carbamate |
|---|---|
| PubChem CID | 155693682 |
| Molecular Formula | C23H39N3O2S |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 2-(2-cyclohexyl-1,3-thiazol-5-yl)aniline;ethane;propan-2-yl carbamate |
| SMILES | CC.CC.CC(C)OC(N)=O.Nc1ccccc1-c1cnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C15H18N2S.C4H9NO2.2C2H6/c16-13-9-5-4-8-12(13)14-10-17-15(18-14)11-6-2-1-3-7-11;1-3(2)7-4(5)6;2*1-2/h4-5,8-11H,1-3,6-7,16H2;3H,1-2H3,(H2,5,6);2*1-2H3 |
| InChIKey | JRQIKBCHQCXBEO-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|