C25H36N2O5S — CID 169263646
methyl 2-[4-(2-cyclohexyl-1,3-thiazol-5-yl)-3-(hydroxyamino)phenyl]acetate;propan-2-yl butanoate (PubChem CID 169263646) has the molecular formula C25H36N2O5S and a molecular weight of 476.64 g/mol. Its IUPAC name is methyl 2-[4-(2-cyclohexyl-1,3-thiazol-5-yl)-3-(hydroxyamino)phenyl]acetate;propan-2-yl butanoate.
| Compound Name | methyl 2-[4-(2-cyclohexyl-1,3-thiazol-5-yl)-3-(hydroxyamino)phenyl]acetate;propan-2-yl butanoate |
|---|---|
| PubChem CID | 169263646 |
| Molecular Formula | C25H36N2O5S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | methyl 2-[4-(2-cyclohexyl-1,3-thiazol-5-yl)-3-(hydroxyamino)phenyl]acetate;propan-2-yl butanoate |
| SMILES | CCCC(=O)OC(C)C.COC(=O)Cc1ccc(-c2cnc(C3CCCCC3)s2)c(NO)c1 |
| InChI | InChI=1S/C18H22N2O3S.C7H14O2/c1-23-17(21)10-12-7-8-14(15(9-12)20-22)16-11-19-18(24-16)13-5-3-2-4-6-13;1-4-5-7(8)9-6(2)3/h7-9,11,13,20,22H,2-6,10H2,1H3;6H,4-5H2,1-3H3 |
| InChIKey | JJGBIBQQBURWEM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|