C29H47N6O3S2+ — CID 169263540
[5-[[N'-[(E)-but-1-enyl]carbamimidoyl]amino]-2-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-(ethylamino)-hydroxy-sulfanylazanium;propan-2-yl butanoate (PubChem CID 169263540) has the molecular formula C29H47N6O3S2+ and a molecular weight of 591.87 g/mol. Its IUPAC name is [5-[[N'-[(E)-but-1-enyl]carbamimidoyl]amino]-2-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-(ethylamino)-hydroxy-sulfanylazanium;propan-2-yl butanoate.
| Compound Name | [5-[[N'-[(E)-but-1-enyl]carbamimidoyl]amino]-2-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-(ethylamino)-hydroxy-sulfanylazanium;propan-2-yl butanoate |
|---|---|
| PubChem CID | 169263540 |
| Molecular Formula | C29H47N6O3S2+ |
| Molecular Weight | 591.87 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | [5-[[N'-[(E)-but-1-enyl]carbamimidoyl]amino]-2-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-(ethylamino)-hydroxy-sulfanylazanium;propan-2-yl butanoate |
| SMILES | CC/C=C/N=C(\N)Nc1ccc(-c2cnc(C3CCCCC3)s2)c([N+](O)(S)NCC)c1.CCCC(=O)OC(C)C |
| InChI | InChI=1S/C22H33N6OS2.C7H14O2/c1-3-5-13-24-22(23)27-17-11-12-18(19(14-17)28(29,30)26-4-2)20-15-25-21(31-20)16-9-7-6-8-10-16;1-4-5-7(8)9-6(2)3/h5,11-16,26,29-30H,3-4,6-10H2,1-2H3,(H3,23,24,27);6H,4-5H2,1-3H3/q+1;/b13-5+; |
| InChIKey | KICMQNBCRUKFCJ-CMZQJCRFSA-N |
| XLogP | 7.31 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.87 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|