C23H33N5OS2 — CID 155693735
2-(2-cyclohexyl-1,3-thiazol-5-yl)-5-[[(1E,3Z)-1,4-diaminohexa-1,3-dienyl]amino]-N-ethylbenzenesulfinamide (PubChem CID 155693735) has the molecular formula C23H33N5OS2 and a molecular weight of 459.69 g/mol. Its IUPAC name is 2-(2-cyclohexyl-1,3-thiazol-5-yl)-5-[[(1E,3Z)-1,4-diaminohexa-1,3-dienyl]amino]-N-ethylbenzenesulfinamide.
| Compound Name | 2-(2-cyclohexyl-1,3-thiazol-5-yl)-5-[[(1E,3Z)-1,4-diaminohexa-1,3-dienyl]amino]-N-ethylbenzenesulfinamide |
|---|---|
| PubChem CID | 155693735 |
| Molecular Formula | C23H33N5OS2 |
| Molecular Weight | 459.69 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 2-(2-cyclohexyl-1,3-thiazol-5-yl)-5-[[(1E,3Z)-1,4-diaminohexa-1,3-dienyl]amino]-N-ethylbenzenesulfinamide |
| SMILES | CCNS(=O)c1cc(N/C(N)=C/C=C(\N)CC)ccc1-c1cnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C23H33N5OS2/c1-3-17(24)10-13-22(25)28-18-11-12-19(21(14-18)31(29)27-4-2)20-15-26-23(30-20)16-8-6-5-7-9-16/h10-16,27-28H,3-9,24-25H2,1-2H3/b17-10-,22-13+ |
| InChIKey | MCIOVWNBQDJXIY-KWHVPRLASA-N |
| XLogP | 4.95 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.69 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|